C10H15NO2S2 — CID 54582734
(5-oxo-2H-furan-3-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 54582734) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is (5-oxo-2H-furan-3-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (5-oxo-2H-furan-3-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 54582734 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (5-oxo-2H-furan-3-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC1=CC(=O)OC1 |
| InChI | InChI=1S/C10H15NO2S2/c1-3-11(4-2)10(14)15-7-8-5-9(12)13-6-8/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | KBJNPXLBBWCNAZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|