C17H20N2O4S2 — CID 100985282
(2,5-dioxopyrrolidin-1-yl) 4-(diethylcarbamothioylsulfanylmethyl)benzoate (PubChem CID 100985282) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(diethylcarbamothioylsulfanylmethyl)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(diethylcarbamothioylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 100985282 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(diethylcarbamothioylsulfanylmethyl)benzoate |
| SMILES | CCN(CC)C(=S)SCc1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-3-18(4-2)17(24)25-11-12-5-7-13(8-6-12)16(22)23-19-14(20)9-10-15(19)21/h5-8H,3-4,9-11H2,1-2H3 |
| InChIKey | PTTZFIIDFRBBIQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|