C29H33NO5 — CID 144616966
(2,5-dioxopyrrolidin-1-yl) 4-[(4-methylphenyl)methyl]benzoate;ethane;1-methoxy-4-methylbenzene (PubChem CID 144616966) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(4-methylphenyl)methyl]benzoate;ethane;1-methoxy-4-methylbenzene.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(4-methylphenyl)methyl]benzoate;ethane;1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 144616966 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(4-methylphenyl)methyl]benzoate;ethane;1-methoxy-4-methylbenzene |
| SMILES | CC.COc1ccc(C)cc1.Cc1ccc(Cc2ccc(C(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C19H17NO4.C8H10O.C2H6/c1-13-2-4-14(5-3-13)12-15-6-8-16(9-7-15)19(23)24-20-17(21)10-11-18(20)22;1-7-3-5-8(9-2)6-4-7;1-2/h2-9H,10-12H2,1H3;3-6H,1-2H3;1-2H3 |
| InChIKey | SGQNADLBJBMDEY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|