C26H24INO5 — CID 159515860
(2,5-dioxopyrrolidin-1-yl) 4-[[3-[(4-methoxyphenyl)-methyl-λ3-iodanyl]phenyl]methyl]benzoate (PubChem CID 159515860) has the molecular formula C26H24INO5 and a molecular weight of 557.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[3-[(4-methoxyphenyl)-methyl-λ3-iodanyl]phenyl]methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[3-[(4-methoxyphenyl)-methyl-λ3-iodanyl]phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 159515860 |
| Molecular Formula | C26H24INO5 |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[3-[(4-methoxyphenyl)-methyl-λ3-iodanyl]phenyl]methyl]benzoate |
| SMILES | COc1ccc(I(C)c2cccc(Cc3ccc(C(=O)ON4C(=O)CCC4=O)cc3)c2)cc1 |
| InChI | InChI=1S/C26H24INO5/c1-27(21-10-12-23(32-2)13-11-21)22-5-3-4-19(17-22)16-18-6-8-20(9-7-18)26(31)33-28-24(29)14-15-25(28)30/h3-13,17H,14-16H2,1-2H3 |
| InChIKey | VRSLEULHWHWWKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|