C20H15NO4 — CID 129054191
(2,5-dioxopyrrolidin-1-yl) 4-[2-(4-methylphenyl)ethynyl]benzoate (PubChem CID 129054191) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-(4-methylphenyl)ethynyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-(4-methylphenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 129054191 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-(4-methylphenyl)ethynyl]benzoate |
| SMILES | Cc1ccc(C#Cc2ccc(C(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C20H15NO4/c1-14-2-4-15(5-3-14)6-7-16-8-10-17(11-9-16)20(24)25-21-18(22)12-13-19(21)23/h2-5,8-11H,12-13H2,1H3 |
| InChIKey | SPXKJVSDFQZFBP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|