C19H15NO6 — CID 89390468
methyl 4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]benzoate (PubChem CID 89390468) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is methyl 4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]benzoate.
| Compound Name | methyl 4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]benzoate |
|---|---|
| PubChem CID | 89390468 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl 4-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C19H15NO6/c1-25-18(23)14-6-2-12(3-7-14)13-4-8-15(9-5-13)19(24)26-20-16(21)10-11-17(20)22/h2-9H,10-11H2,1H3 |
| InChIKey | TWCCWZOYYKAWEE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|