C12H9N3O4 — CID 89373287
(2,5-dioxopyrrolidin-1-yl) 4-(cyanoamino)benzoate (PubChem CID 89373287) has the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(cyanoamino)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(cyanoamino)benzoate |
|---|---|
| PubChem CID | 89373287 |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(cyanoamino)benzoate |
| SMILES | N#CNc1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C12H9N3O4/c13-7-14-9-3-1-8(2-4-9)12(18)19-15-10(16)5-6-11(15)17/h1-4,14H,5-6H2 |
| InChIKey | BWVMSOJGVPAGDG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|