C24H25ClN8O8S2 — CID 131717889
bis((2,5-dioxopyrrolidin-1-yl) 4-(2-carbamothioylhydrazinyl)benzoate);hydrochloride (PubChem CID 131717889) has the molecular formula C24H25ClN8O8S2 and a molecular weight of 653.10 g/mol. Its IUPAC name is bis((2,5-dioxopyrrolidin-1-yl) 4-(2-carbamothioylhydrazinyl)benzoate);hydrochloride.
| Compound Name | bis((2,5-dioxopyrrolidin-1-yl) 4-(2-carbamothioylhydrazinyl)benzoate);hydrochloride |
|---|---|
| PubChem CID | 131717889 |
| Molecular Formula | C24H25ClN8O8S2 |
| Molecular Weight | 653.10 g/mol |
| Exact Mass | 652.09 |
| IUPAC Name | bis((2,5-dioxopyrrolidin-1-yl) 4-(2-carbamothioylhydrazinyl)benzoate);hydrochloride |
| SMILES | Cl.NC(=S)NNc1ccc(C(=O)ON2C(=O)CCC2=O)cc1.NC(=S)NNc1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/2C12H12N4O4S.ClH/c2*13-12(21)15-14-8-3-1-7(2-4-8)11(19)20-16-9(17)5-6-10(16)18;/h2*1-4,14H,5-6H2,(H3,13,15,21);1H |
| InChIKey | RJSYGMBNJJRUHK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 227.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.10 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|