C17H19N3O5 — CID 58732095
(2,5-dioxopyrrolidin-1-yl) 4-(cyclopentylcarbamoylamino)benzoate (PubChem CID 58732095) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(cyclopentylcarbamoylamino)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(cyclopentylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 58732095 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(cyclopentylcarbamoylamino)benzoate |
| SMILES | O=C(Nc1ccc(C(=O)ON2C(=O)CCC2=O)cc1)NC1CCCC1 |
| InChI | InChI=1S/C17H19N3O5/c21-14-9-10-15(22)20(14)25-16(23)11-5-7-13(8-6-11)19-17(24)18-12-3-1-2-4-12/h5-8,12H,1-4,9-10H2,(H2,18,19,24) |
| InChIKey | WGHZODVEMHVQQC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|