C15H12N2O6S2 — CID 86641213
(2,5-dioxopyrrolidin-1-yl) 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 86641213) has the molecular formula C15H12N2O6S2 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 86641213 |
| Molecular Formula | C15H12N2O6S2 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H12N2O6S2/c18-12-7-8-13(19)17(12)23-15(20)10-3-5-11(6-4-10)16-25(21,22)14-2-1-9-24-14/h1-6,9,16H,7-8H2 |
| InChIKey | MVQLPRVQBOKGQM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|