C20H24N2O5S2 — CID 2347107
[2-(cyclohexylmethylamino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2347107) has the molecular formula C20H24N2O5S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2347107 |
| Molecular Formula | C20H24N2O5S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)NCC1CCCCC1 |
| InChI | InChI=1S/C20H24N2O5S2/c23-18(21-13-15-5-2-1-3-6-15)14-27-20(24)16-8-10-17(11-9-16)22-29(25,26)19-7-4-12-28-19/h4,7-12,15,22H,1-3,5-6,13-14H2,(H,21,23) |
| InChIKey | PEYYPVJDIOOUCS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |