C21H24N2O5S2 — CID 2463276
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 2463276) has the molecular formula C21H24N2O5S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2463276 |
| Molecular Formula | C21H24N2O5S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H24N2O5S2/c24-19(22-13-12-16-5-2-1-3-6-16)15-28-21(25)17-8-10-18(11-9-17)23-30(26,27)20-7-4-14-29-20/h4-5,7-11,14,23H,1-3,6,12-13,15H2,(H,22,24) |
| InChIKey | WXUOMXRITXQRGT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|