C24H34N2O5S — CID 16501634
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 16501634) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16501634 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)OCC(=O)NCCC3=CCCCC3)cc2)C1 |
| InChI | InChI=1S/C24H34N2O5S/c1-18-14-19(2)16-26(15-18)32(29,30)22-10-8-21(9-11-22)24(28)31-17-23(27)25-13-12-20-6-4-3-5-7-20/h6,8-11,18-19H,3-5,7,12-17H2,1-2H3,(H,25,27) |
| InChIKey | QZOQZUJYXYNWFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|