C24H34N2O6S — CID 42898128
[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate (PubChem CID 42898128) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate.
| Compound Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 42898128 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)OC(C)C(=O)NCCC3=CCCCC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C24H34N2O6S/c1-17-15-26(16-18(2)31-17)33(29,30)22-11-9-21(10-12-22)24(28)32-19(3)23(27)25-14-13-20-7-5-4-6-8-20/h7,9-12,17-19H,4-6,8,13-16H2,1-3H3,(H,25,27) |
| InChIKey | WAGHNJYYPDBTIS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|