C20H27NO3 — CID 7364710
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-ethylbenzoate (PubChem CID 7364710) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-ethylbenzoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 7364710 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)O[C@@H](C)C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C20H27NO3/c1-3-16-9-11-18(12-10-16)20(23)24-15(2)19(22)21-14-13-17-7-5-4-6-8-17/h7,9-12,15H,3-6,8,13-14H2,1-2H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | FIGHEGZEXLFXPI-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|