C20H26N2O4 — CID 7418280
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-acetamidobenzoate (PubChem CID 7418280) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-acetamidobenzoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 7418280 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)O[C@@H](C)C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C20H26N2O4/c1-14(19(24)21-12-11-16-7-4-3-5-8-16)26-20(25)17-9-6-10-18(13-17)22-15(2)23/h6-7,9-10,13-14H,3-5,8,11-12H2,1-2H3,(H,21,24)(H,22,23)/t14-/m0/s1 |
| InChIKey | STFZKBXQIGZCHR-AWEZNQCLSA-N |
| XLogP | 3.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|