C21H29NO6 — CID 8013356
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate (PubChem CID 8013356) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8013356 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O[C@@H](C)C(=O)NCCC2=CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H29NO6/c1-14(20(23)22-11-10-15-8-6-5-7-9-15)28-21(24)16-12-17(25-2)19(27-4)18(13-16)26-3/h8,12-14H,5-7,9-11H2,1-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | SXIGMPHJGGEEDD-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|