C19H25NO5S — CID 7744733
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-methylsulfonylbenzoate (PubChem CID 7744733) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-methylsulfonylbenzoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7744733 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(S(C)(=O)=O)cc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H25NO5S/c1-14(18(21)20-13-12-15-6-4-3-5-7-15)25-19(22)16-8-10-17(11-9-16)26(2,23)24/h6,8-11,14H,3-5,7,12-13H2,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | YLKYKKMIIDIJAS-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|