C25H27NO4 — CID 7211569
[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate (PubChem CID 7211569) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate.
| Compound Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7211569 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-benzoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C(=O)c2ccccc2)cc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C25H27NO4/c1-18(24(28)26-17-16-19-8-4-2-5-9-19)30-25(29)22-14-12-21(13-15-22)23(27)20-10-6-3-7-11-20/h3,6-8,10-15,18H,2,4-5,9,16-17H2,1H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | MGLLLXNADOLAAU-GOSISDBHSA-N |
| XLogP | 4.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|