C20H27NO5 — CID 8011368
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4-dimethoxybenzoate (PubChem CID 8011368) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4-dimethoxybenzoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 8011368 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)NCCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C20H27NO5/c1-14(19(22)21-12-11-15-7-5-4-6-8-15)26-20(23)16-9-10-17(24-2)18(13-16)25-3/h7,9-10,13-14H,4-6,8,11-12H2,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | FXXXQVFCUTYHJY-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|