C21H29NO3 — CID 7671540
[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-propan-2-ylbenzoate (PubChem CID 7671540) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-propan-2-ylbenzoate.
| Compound Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 7671540 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)O[C@H](C)C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H29NO3/c1-15(2)18-9-11-19(12-10-18)21(24)25-16(3)20(23)22-14-13-17-7-5-4-6-8-17/h7,9-12,15-16H,4-6,8,13-14H2,1-3H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | IMIJXFZTULCWQX-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|