C25H29NO4 — CID 18272072
[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(phenoxymethyl)benzoate (PubChem CID 18272072) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(phenoxymethyl)benzoate.
| Compound Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(phenoxymethyl)benzoate |
|---|---|
| PubChem CID | 18272072 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(phenoxymethyl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1COc1ccccc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C25H29NO4/c1-19(24(27)26-17-16-20-10-4-2-5-11-20)30-25(28)23-15-9-8-12-21(23)18-29-22-13-6-3-7-14-22/h3,6-10,12-15,19H,2,4-5,11,16-18H2,1H3,(H,26,27) |
| InChIKey | LUMUAOJMTRRQCY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|