C19H25NO4 — CID 7568062
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate (PubChem CID 7568062) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 7568062 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)NCCC2=CCCCC2)c(O)c1 |
| InChI | InChI=1S/C19H25NO4/c1-13-8-9-16(17(21)12-13)19(23)24-14(2)18(22)20-11-10-15-6-4-3-5-7-15/h6,8-9,12,14,21H,3-5,7,10-11H2,1-2H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | MIPHXHMYQKYIBC-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|