C26H27NO3 — CID 3882683
[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] anthracene-9-carboxylate (PubChem CID 3882683) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] anthracene-9-carboxylate.
| Compound Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 3882683 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] anthracene-9-carboxylate |
| SMILES | CC(OC(=O)c1c2ccccc2cc2ccccc12)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C26H27NO3/c1-18(25(28)27-16-15-19-9-3-2-4-10-19)30-26(29)24-22-13-7-5-11-20(22)17-21-12-6-8-14-23(21)24/h5-9,11-14,17-18H,2-4,10,15-16H2,1H3,(H,27,28) |
| InChIKey | LUJSSQRLXBQDML-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|