C22H26ClN3O3 — CID 7557537
[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 7557537) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7557537 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)O[C@H](C)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-15-19(20(23)26(25-15)18-11-7-4-8-12-18)22(28)29-16(2)21(27)24-14-13-17-9-5-3-6-10-17/h4,7-9,11-12,16H,3,5-6,10,13-14H2,1-2H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | DUWWGUSPCVDDJP-MRXNPFEDSA-N |
| XLogP | 4.39 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|