C19H23F2NO4 — CID 18078141
[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate (PubChem CID 18078141) has the molecular formula C19H23F2NO4 and a molecular weight of 367.39 g/mol. Its IUPAC name is [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate.
| Compound Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18078141 |
| Molecular Formula | C19H23F2NO4 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(difluoromethoxy)benzoate |
| SMILES | CC(OC(=O)c1ccccc1OC(F)F)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H23F2NO4/c1-13(17(23)22-12-11-14-7-3-2-4-8-14)25-18(24)15-9-5-6-10-16(15)26-19(20)21/h5-7,9-10,13,19H,2-4,8,11-12H2,1H3,(H,22,23) |
| InChIKey | MCRPVRJRZSCPEQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|