C22H30N2O5 — CID 7807780
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 7807780) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7807780 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)O[C@@H](C)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H30N2O5/c1-3-28-19-12-8-7-11-18(19)22(27)24-15-20(25)29-16(2)21(26)23-14-13-17-9-5-4-6-10-17/h7-9,11-12,16H,3-6,10,13-15H2,1-2H3,(H,23,26)(H,24,27)/t16-/m0/s1 |
| InChIKey | VQVFPLBSRVWLIG-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|