C20H23N3O3 — CID 42884187
[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] quinoxaline-2-carboxylate (PubChem CID 42884187) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] quinoxaline-2-carboxylate.
| Compound Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 42884187 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] quinoxaline-2-carboxylate |
| SMILES | CC(OC(=O)c1cnc2ccccc2n1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H23N3O3/c1-14(19(24)21-12-11-15-7-3-2-4-8-15)26-20(25)18-13-22-16-9-5-6-10-17(16)23-18/h5-7,9-10,13-14H,2-4,8,11-12H2,1H3,(H,21,24) |
| InChIKey | UQKJPAAIFAVQQR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|