C18H22N2O3 — CID 108984198
N'-(3-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]oxamide (PubChem CID 108984198) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]oxamide.
| Compound Name | N'-(3-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108984198 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N'-(3-acetylphenyl)-N-[2-(cyclohexen-1-yl)ethyl]oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-13(21)15-8-5-9-16(12-15)20-18(23)17(22)19-11-10-14-6-3-2-4-7-14/h5-6,8-9,12H,2-4,7,10-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | RNAZKGOUTRVZJR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|