C20H27N3O3 — CID 87039300
N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-morpholin-4-ylphenyl)oxamide (PubChem CID 87039300) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-morpholin-4-ylphenyl)oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 87039300 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-morpholin-4-ylphenyl)oxamide |
| SMILES | O=C(NCCC1=CCCCC1)C(=O)Nc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H27N3O3/c24-19(21-10-9-16-5-2-1-3-6-16)20(25)22-17-7-4-8-18(15-17)23-11-13-26-14-12-23/h4-5,7-8,15H,1-3,6,9-14H2,(H,21,24)(H,22,25) |
| InChIKey | BLFIIWQQPZIZNC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|