C21H30N4O3 — CID 109095559
2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-dicarboxamide (PubChem CID 109095559) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095559 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-6-N-(2-morpholin-4-ylethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cccc(C(=O)NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C21H30N4O3/c26-20(22-10-9-17-5-2-1-3-6-17)18-7-4-8-19(24-18)21(27)23-11-12-25-13-15-28-16-14-25/h4-5,7-8H,1-3,6,9-16H2,(H,22,26)(H,23,27) |
| InChIKey | IRQHGGHJHLAXOA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|