C24H37N5O3S — CID 5010500
2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylethyl)-1,3-thiazole-4-carboxamide (PubChem CID 5010500) has the molecular formula C24H37N5O3S and a molecular weight of 475.66 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 5010500 |
| Molecular Formula | C24H37N5O3S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1csc(C2CCN(C(=O)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C24H37N5O3S/c30-22(25-10-13-28-14-16-32-17-15-28)21-18-33-23(27-21)20-7-11-29(12-8-20)24(31)26-9-6-19-4-2-1-3-5-19/h4,18,20H,1-3,5-17H2,(H,25,30)(H,26,31) |
| InChIKey | GWMGVAYQPASLBI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|