C24H35N5O3S — CID 23991965
2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-oxoazepan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 23991965) has the molecular formula C24H35N5O3S and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-oxoazepan-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-oxoazepan-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 23991965 |
| Molecular Formula | C24H35N5O3S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-oxoazepan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCNC1=O)c1csc(C2CCN(C(=O)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C24H35N5O3S/c30-21-19(8-4-5-12-25-21)27-22(31)20-16-33-23(28-20)18-10-14-29(15-11-18)24(32)26-13-9-17-6-2-1-3-7-17/h6,16,18-19H,1-5,7-15H2,(H,25,30)(H,26,32)(H,27,31) |
| InChIKey | NDRQLTWHVFECQU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|