C13H19N3O2S — CID 97152900
N-[(3R)-2-oxoazepan-3-yl]-2-propyl-1,3-thiazole-4-carboxamide (PubChem CID 97152900) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[(3R)-2-oxoazepan-3-yl]-2-propyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3R)-2-oxoazepan-3-yl]-2-propyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 97152900 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[(3R)-2-oxoazepan-3-yl]-2-propyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCc1nc(C(=O)N[C@@H]2CCCCNC2=O)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-2-5-11-15-10(8-19-11)13(18)16-9-6-3-4-7-14-12(9)17/h8-9H,2-7H2,1H3,(H,14,17)(H,16,18)/t9-/m1/s1 |
| InChIKey | LORWAWIDHHBUDK-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |