C24H32N4O2S2 — CID 3875929
2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide (PubChem CID 3875929) has the molecular formula C24H32N4O2S2 and a molecular weight of 472.68 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3875929 |
| Molecular Formula | C24H32N4O2S2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1csc(C2CCN(C(=O)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C24H32N4O2S2/c29-22(25-13-9-20-7-4-16-31-20)21-17-32-23(27-21)19-10-14-28(15-11-19)24(30)26-12-8-18-5-2-1-3-6-18/h4-5,7,16-17,19H,1-3,6,8-15H2,(H,25,29)(H,26,30) |
| InChIKey | BWNHZKCVDBEPEH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|