C22H31N3O5S2 — CID 3685355
2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide (PubChem CID 3685355) has the molecular formula C22H31N3O5S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3685355 |
| Molecular Formula | C22H31N3O5S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-(2-thiophen-2-ylethyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCOCCOCC(=O)N1CCC(c2nc(C(=O)NCCc3cccs3)cs2)CC1 |
| InChI | InChI=1S/C22H31N3O5S2/c1-28-10-11-29-12-13-30-15-20(26)25-8-5-17(6-9-25)22-24-19(16-32-22)21(27)23-7-4-18-3-2-14-31-18/h2-3,14,16-17H,4-13,15H2,1H3,(H,23,27) |
| InChIKey | GZLCSKNTSCZFRE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|