C25H34N4O7S — CID 3413948
2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 3413948) has the molecular formula C25H34N4O7S and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3413948 |
| Molecular Formula | C25H34N4O7S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 2-[1-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]piperidin-4-yl]-N-methyl-N-[2-(4-nitrophenyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCOCCOCC(=O)N1CCC(c2nc(C(=O)N(C)CCc3ccc([N+](=O)[O-])cc3)cs2)CC1 |
| InChI | InChI=1S/C25H34N4O7S/c1-27(10-7-19-3-5-21(6-4-19)29(32)33)25(31)22-18-37-24(26-22)20-8-11-28(12-9-20)23(30)17-36-16-15-35-14-13-34-2/h3-6,18,20H,7-17H2,1-2H3 |
| InChIKey | QIGJYLLKYOLSBS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 124.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|