C24H32FN3O3S — CID 3870448
2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 3870448) has the molecular formula C24H32FN3O3S and a molecular weight of 461.60 g/mol. Its IUPAC name is 2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3870448 |
| Molecular Formula | C24H32FN3O3S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)COCCCNC(=O)c1csc(C2CCN(C(=O)Cc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C24H32FN3O3S/c1-17(2)15-31-13-3-10-26-23(30)21-16-32-24(27-21)19-8-11-28(12-9-19)22(29)14-18-4-6-20(25)7-5-18/h4-7,16-17,19H,3,8-15H2,1-2H3,(H,26,30) |
| InChIKey | BWSAVTPZERIBDU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|