C22H25FN4O5S — CID 3687362
ethyl 3-[2-[2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]hydrazinyl]-3-oxopropanoate (PubChem CID 3687362) has the molecular formula C22H25FN4O5S and a molecular weight of 476.53 g/mol. Its IUPAC name is ethyl 3-[2-[2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]hydrazinyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[2-[2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]hydrazinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 3687362 |
| Molecular Formula | C22H25FN4O5S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | ethyl 3-[2-[2-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]hydrazinyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NNC(=O)c1csc(C2CCN(C(=O)Cc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C22H25FN4O5S/c1-2-32-20(30)12-18(28)25-26-21(31)17-13-33-22(24-17)15-7-9-27(10-8-15)19(29)11-14-3-5-16(23)6-4-14/h3-6,13,15H,2,7-12H2,1H3,(H,25,28)(H,26,31) |
| InChIKey | SKPZMNPDKYZEKO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|