C26H37N3O6S — CID 3698210
N-[3-(2-methylpropoxy)propyl]-2-[1-(2,3,4-trimethoxybenzoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3698210) has the molecular formula C26H37N3O6S and a molecular weight of 519.66 g/mol. Its IUPAC name is N-[3-(2-methylpropoxy)propyl]-2-[1-(2,3,4-trimethoxybenzoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(2-methylpropoxy)propyl]-2-[1-(2,3,4-trimethoxybenzoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3698210 |
| Molecular Formula | C26H37N3O6S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-[3-(2-methylpropoxy)propyl]-2-[1-(2,3,4-trimethoxybenzoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(c3nc(C(=O)NCCCOCC(C)C)cs3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C26H37N3O6S/c1-17(2)15-35-14-6-11-27-24(30)20-16-36-25(28-20)18-9-12-29(13-10-18)26(31)19-7-8-21(32-3)23(34-5)22(19)33-4/h7-8,16-18H,6,9-15H2,1-5H3,(H,27,30) |
| InChIKey | HUBAFMRJQDFJKK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|