C26H37N3O4S — CID 3827498
2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 3827498) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3827498 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(OCC(=O)N2CCC(c3nc(C(=O)NCCCOCC(C)C)cs3)CC2)cc1C |
| InChI | InChI=1S/C26H37N3O4S/c1-18(2)15-32-13-5-10-27-25(31)23-17-34-26(28-23)21-8-11-29(12-9-21)24(30)16-33-22-7-6-19(3)20(4)14-22/h6-7,14,17-18,21H,5,8-13,15-16H2,1-4H3,(H,27,31) |
| InChIKey | MMLKRJIICZKUPL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|