C24H33N7O3S — CID 3722718
2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 3722718) has the molecular formula C24H33N7O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3722718 |
| Molecular Formula | C24H33N7O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[3-(2-methylpropoxy)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc2nnc(C(=O)N3CCC(c4nc(C(=O)NCCCOCC(C)C)cs4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C24H33N7O3S/c1-15(2)13-34-11-5-8-25-22(32)19-14-35-23(26-19)18-6-9-30(10-7-18)24(33)21-17(4)31-20(27-28-21)12-16(3)29-31/h12,14-15,18H,5-11,13H2,1-4H3,(H,25,32) |
| InChIKey | MVICBPYFXFEBHH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|