C21H22N10O3S2 — CID 3760648
N'-[2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-4-methylthiadiazole-5-carbohydrazide (PubChem CID 3760648) has the molecular formula C21H22N10O3S2 and a molecular weight of 526.61 g/mol. Its IUPAC name is N'-[2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-4-methylthiadiazole-5-carbohydrazide.
| Compound Name | N'-[2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-4-methylthiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 3760648 |
| Molecular Formula | C21H22N10O3S2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | N'-[2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]-4-methylthiadiazole-5-carbohydrazide |
| SMILES | Cc1cc2nnc(C(=O)N3CCC(c4nc(C(=O)NNC(=O)c5snnc5C)cs4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C21H22N10O3S2/c1-10-8-15-24-25-16(12(3)31(15)28-10)21(34)30-6-4-13(5-7-30)20-22-14(9-35-20)18(32)26-27-19(33)17-11(2)23-29-36-17/h8-9,13H,4-7H2,1-3H3,(H,26,32)(H,27,33) |
| InChIKey | XEGZMUNWHLYELP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|