C26H29N7O3S — CID 3467798
2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[2-(3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 3467798) has the molecular formula C26H29N7O3S and a molecular weight of 519.63 g/mol. Its IUPAC name is 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[2-(3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[2-(3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3467798 |
| Molecular Formula | C26H29N7O3S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[2-(3-methoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(CCNC(=O)c2csc(C3CCN(C(=O)c4nnc5cc(C)nn5c4C)CC3)n2)c1 |
| InChI | InChI=1S/C26H29N7O3S/c1-16-13-22-29-30-23(17(2)33(22)31-16)26(35)32-11-8-19(9-12-32)25-28-21(15-37-25)24(34)27-10-7-18-5-4-6-20(14-18)36-3/h4-6,13-15,19H,7-12H2,1-3H3,(H,27,34) |
| InChIKey | RTXOWJJRYAGAFR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |