C23H24N8O3S2 — CID 3821297
2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3821297) has the molecular formula C23H24N8O3S2 and a molecular weight of 524.63 g/mol. Its IUPAC name is 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3821297 |
| Molecular Formula | C23H24N8O3S2 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N'-(5-methylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1cc2nnc(C(=O)N3CCC(c4nc(C(=O)NNC(=O)c5ccc(C)s5)cs4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C23H24N8O3S2/c1-12-10-18-25-26-19(14(3)31(18)29-12)23(34)30-8-6-15(7-9-30)22-24-16(11-35-22)20(32)27-28-21(33)17-5-4-13(2)36-17/h4-5,10-11,15H,6-9H2,1-3H3,(H,27,32)(H,28,33) |
| InChIKey | VJVBHKCFYCVFIV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|