C27H30FN7O2S — CID 3481421
2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3481421) has the molecular formula C27H30FN7O2S and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3481421 |
| Molecular Formula | C27H30FN7O2S |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-[1-(4-fluorophenyl)-2-methylpropan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc2nnc(C(=O)N3CCC(c4nc(C(=O)NC(C)(C)Cc5ccc(F)cc5)cs4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C27H30FN7O2S/c1-16-13-22-31-32-23(17(2)35(22)33-16)26(37)34-11-9-19(10-12-34)25-29-21(15-38-25)24(36)30-27(3,4)14-18-5-7-20(28)8-6-18/h5-8,13,15,19H,9-12,14H2,1-4H3,(H,30,36) |
| InChIKey | ZTQNHCWBFGLLIT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |