C26H30N4O3S — CID 3684625
2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide (PubChem CID 3684625) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3684625 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[1-[2-(3,4-dimethylphenoxy)acetyl]piperidin-4-yl]-N'-methyl-N'-phenyl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(OCC(=O)N2CCC(c3nc(C(=O)NN(C)c4ccccc4)cs3)CC2)cc1C |
| InChI | InChI=1S/C26H30N4O3S/c1-18-9-10-22(15-19(18)2)33-16-24(31)30-13-11-20(12-14-30)26-27-23(17-34-26)25(32)28-29(3)21-7-5-4-6-8-21/h4-10,15,17,20H,11-14,16H2,1-3H3,(H,28,32) |
| InChIKey | IWVPWEZRCYCAMI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|