C22H26ClN3O4S — CID 4986353
methyl 4-[[2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]butanoate (PubChem CID 4986353) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is methyl 4-[[2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 4986353 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 4-[[2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1csc(C2CCN(C(=O)Cc3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C22H26ClN3O4S/c1-30-20(28)7-4-10-24-21(29)18-14-31-22(25-18)15-8-11-26(12-9-15)19(27)13-16-5-2-3-6-17(16)23/h2-3,5-6,14-15H,4,7-13H2,1H3,(H,24,29) |
| InChIKey | FCMKAZGUHSBILD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|