C22H22ClN7O2S — CID 3468106
N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3468106) has the molecular formula C22H22ClN7O2S and a molecular weight of 483.99 g/mol. Its IUPAC name is N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3468106 |
| Molecular Formula | C22H22ClN7O2S |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(2-chlorophenyl)acetyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=NNC(=O)c1csc(C2CCN(C(=O)Cc3ccccc3Cl)CC2)n1)c1cnccn1 |
| InChI | InChI=1S/C22H22ClN7O2S/c23-16-4-2-1-3-15(16)11-19(31)30-9-5-14(6-10-30)22-27-18(13-33-22)21(32)29-28-20(24)17-12-25-7-8-26-17/h1-4,7-8,12-14H,5-6,9-11H2,(H2,24,28)(H,29,32) |
| InChIKey | JHWRDERIYMAHEP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|