C22H20F3N7O2S — CID 3810160
N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3810160) has the molecular formula C22H20F3N7O2S and a molecular weight of 503.51 g/mol. Its IUPAC name is N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3810160 |
| Molecular Formula | C22H20F3N7O2S |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[[amino(pyrazin-2-yl)methylidene]amino]-2-[1-[2-(trifluoromethyl)benzoyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=NNC(=O)c1csc(C2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)n1)c1cnccn1 |
| InChI | InChI=1S/C22H20F3N7O2S/c23-22(24,25)15-4-2-1-3-14(15)21(34)32-9-5-13(6-10-32)20-29-17(12-35-20)19(33)31-30-18(26)16-11-27-7-8-28-16/h1-4,7-8,11-13H,5-6,9-10H2,(H2,26,30)(H,31,33) |
| InChIKey | NGSDYUMSYNVYMU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|